C26H34N3O2+ — CID 9460381
(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-bis(2-phenylethyl)azanium (PubChem CID 9460381) has the molecular formula C26H34N3O2+ and a molecular weight of 420.58 g/mol. Its IUPAC name is (2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-bis(2-phenylethyl)azanium.
| Compound Name | (2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-bis(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 9460381 |
| Molecular Formula | C26H34N3O2+ |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | (2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)methyl-bis(2-phenylethyl)azanium |
| SMILES | O=C1NC2(CCCCCC2)C(=O)N1C[NH+](CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C26H33N3O2/c30-24-26(17-9-1-2-10-18-26)27-25(31)29(24)21-28(19-15-22-11-5-3-6-12-22)20-16-23-13-7-4-8-14-23/h3-8,11-14H,1-2,9-10,15-21H2,(H,27,31)/p+1 |
| InChIKey | KGLLLSZCSYTNRN-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|