C24H35N3O2 — CID 55484424
3-[[4-(2-phenylethyl)piperidin-1-yl]methyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione (PubChem CID 55484424) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 3-[[4-(2-phenylethyl)piperidin-1-yl]methyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione.
| Compound Name | 3-[[4-(2-phenylethyl)piperidin-1-yl]methyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
|---|---|
| PubChem CID | 55484424 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 3-[[4-(2-phenylethyl)piperidin-1-yl]methyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
| SMILES | O=C1NC2(CCCCCCC2)C(=O)N1CN1CCC(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H35N3O2/c28-22-24(15-7-2-1-3-8-16-24)25-23(29)27(22)19-26-17-13-21(14-18-26)12-11-20-9-5-4-6-10-20/h4-6,9-10,21H,1-3,7-8,11-19H2,(H,25,29) |
| InChIKey | WWHGROQPGWQRQC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|