C15H24N4O3 — CID 2516681
1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperidine-4-carboxamide (PubChem CID 2516681) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2516681 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CN2C(=O)NC3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C15H24N4O3/c16-12(20)11-4-8-18(9-5-11)10-19-13(21)15(17-14(19)22)6-2-1-3-7-15/h11H,1-10H2,(H2,16,20)(H,17,22) |
| InChIKey | MNGSAGRNRLLTDA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|