C20H26N5O3+ — CID 135751657
(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135751657) has the molecular formula C20H26N5O3+ and a molecular weight of 384.46 g/mol. Its IUPAC name is (2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | (2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135751657 |
| Molecular Formula | C20H26N5O3+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CC[NH+](Cc1nc2ccccc2c(=O)[nH]1)CN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C20H25N5O3/c1-2-24(12-16-21-15-9-5-4-8-14(15)17(26)22-16)13-25-18(27)20(23-19(25)28)10-6-3-7-11-20/h4-5,8-9H,2-3,6-7,10-13H2,1H3,(H,23,28)(H,21,22,26)/p+1 |
| InChIKey | JUCPQJBOQNJZSI-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|