C25H25N4O2+ — CID 135808249
ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[4-(phenylcarbamoyl)phenyl]methyl]azanium (PubChem CID 135808249) has the molecular formula C25H25N4O2+ and a molecular weight of 413.50 g/mol. Its IUPAC name is ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[4-(phenylcarbamoyl)phenyl]methyl]azanium.
| Compound Name | ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[4-(phenylcarbamoyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 135808249 |
| Molecular Formula | C25H25N4O2+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]-[[4-(phenylcarbamoyl)phenyl]methyl]azanium |
| SMILES | CC[NH+](Cc1ccc(C(=O)Nc2ccccc2)cc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-29(17-23-27-22-11-7-6-10-21(22)25(31)28-23)16-18-12-14-19(15-13-18)24(30)26-20-8-4-3-5-9-20/h3-15H,2,16-17H2,1H3,(H,26,30)(H,27,28,31)/p+1 |
| InChIKey | PLZCNPMJJKQJEK-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |