C21H24N3O3+ — CID 135808487
(5-acetyl-2-methoxyphenyl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135808487) has the molecular formula C21H24N3O3+ and a molecular weight of 366.44 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135808487 |
| Molecular Formula | C21H24N3O3+ |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl-ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CC[NH+](Cc1nc2ccccc2c(=O)[nH]1)Cc1cc(C(C)=O)ccc1OC |
| InChI | InChI=1S/C21H23N3O3/c1-4-24(12-16-11-15(14(2)25)9-10-19(16)27-3)13-20-22-18-8-6-5-7-17(18)21(26)23-20/h5-11H,4,12-13H2,1-3H3,(H,22,23,26)/p+1 |
| InChIKey | BCGYPCTYFAHITL-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |