C14H22NO2+ — CID 6943942
(5-acetyl-2-methoxyphenyl)methyl-diethylazanium (PubChem CID 6943942) has the molecular formula C14H22NO2+ and a molecular weight of 236.34 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl-diethylazanium.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl-diethylazanium |
|---|---|
| PubChem CID | 6943942 |
| Molecular Formula | C14H22NO2+ |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1cc(C(C)=O)ccc1OC |
| InChI | InChI=1S/C14H21NO2/c1-5-15(6-2)10-13-9-12(11(3)16)7-8-14(13)17-4/h7-9H,5-6,10H2,1-4H3/p+1 |
| InChIKey | HWQXADPWWSVKPV-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |