C22H30N3O3+ — CID 9359284
diethyl-[[2-methoxy-5-[(Z)-N-[(4-methoxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]methyl]azanium (PubChem CID 9359284) has the molecular formula C22H30N3O3+ and a molecular weight of 384.50 g/mol. Its IUPAC name is diethyl-[[2-methoxy-5-[(Z)-N-[(4-methoxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-methoxy-5-[(Z)-N-[(4-methoxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9359284 |
| Molecular Formula | C22H30N3O3+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | diethyl-[[2-methoxy-5-[(Z)-N-[(4-methoxybenzoyl)amino]-C-methylcarbonimidoyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N\NC(=O)c2ccc(OC)cc2)ccc1OC |
| InChI | InChI=1S/C22H29N3O3/c1-6-25(7-2)15-19-14-18(10-13-21(19)28-5)16(3)23-24-22(26)17-8-11-20(27-4)12-9-17/h8-14H,6-7,15H2,1-5H3,(H,24,26)/p+1/b23-16- |
| InChIKey | OHGBDVLFXMOINF-KQWNVCNZSA-O |
| XLogP | 2.28 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|