C20H27N4O2+ — CID 9059844
diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-(pyridine-3-carbonylamino)carbonimidoyl]phenyl]methyl]azanium (PubChem CID 9059844) has the molecular formula C20H27N4O2+ and a molecular weight of 355.46 g/mol. Its IUPAC name is diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-(pyridine-3-carbonylamino)carbonimidoyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-(pyridine-3-carbonylamino)carbonimidoyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9059844 |
| Molecular Formula | C20H27N4O2+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-(pyridine-3-carbonylamino)carbonimidoyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N\NC(=O)c2cccnc2)ccc1OC |
| InChI | InChI=1S/C20H26N4O2/c1-5-24(6-2)14-18-12-16(9-10-19(18)26-4)15(3)22-23-20(25)17-8-7-11-21-13-17/h7-13H,5-6,14H2,1-4H3,(H,23,25)/p+1/b22-15- |
| InChIKey | QBAVFWXLRSJMFC-JCMHNJIXSA-O |
| XLogP | 1.67 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|