C21H27N4O4+ — CID 9014892
diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-[(4-nitrobenzoyl)amino]carbonimidoyl]phenyl]methyl]azanium (PubChem CID 9014892) has the molecular formula C21H27N4O4+ and a molecular weight of 399.47 g/mol. Its IUPAC name is diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-[(4-nitrobenzoyl)amino]carbonimidoyl]phenyl]methyl]azanium.
| Compound Name | diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-[(4-nitrobenzoyl)amino]carbonimidoyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9014892 |
| Molecular Formula | C21H27N4O4+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | diethyl-[[2-methoxy-5-[(Z)-C-methyl-N-[(4-nitrobenzoyl)amino]carbonimidoyl]phenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N\NC(=O)c2ccc([N+](=O)[O-])cc2)ccc1OC |
| InChI | InChI=1S/C21H26N4O4/c1-5-24(6-2)14-18-13-17(9-12-20(18)29-4)15(3)22-23-21(26)16-7-10-19(11-8-16)25(27)28/h7-13H,5-6,14H2,1-4H3,(H,23,26)/p+1/b22-15- |
| InChIKey | UJOWCALRGNKGKG-JCMHNJIXSA-O |
| XLogP | 2.18 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|