C21H27FN3O2+ — CID 9016644
diethyl-[[5-[(Z)-N-[(4-fluorobenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl]azanium (PubChem CID 9016644) has the molecular formula C21H27FN3O2+ and a molecular weight of 372.46 g/mol. Its IUPAC name is diethyl-[[5-[(Z)-N-[(4-fluorobenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl]azanium.
| Compound Name | diethyl-[[5-[(Z)-N-[(4-fluorobenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl]azanium |
|---|---|
| PubChem CID | 9016644 |
| Molecular Formula | C21H27FN3O2+ |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | diethyl-[[5-[(Z)-N-[(4-fluorobenzoyl)amino]-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl]azanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N\NC(=O)c2ccc(F)cc2)ccc1OC |
| InChI | InChI=1S/C21H26FN3O2/c1-5-25(6-2)14-18-13-17(9-12-20(18)27-4)15(3)23-24-21(26)16-7-10-19(22)11-8-16/h7-13H,5-6,14H2,1-4H3,(H,24,26)/p+1/b23-15- |
| InChIKey | SJDHPGZEUUAJIZ-HAHDFKILSA-O |
| XLogP | 2.41 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|