C18H28N3O2+ — CID 9234386
[5-[(Z)-N-(cyclopropanecarbonylamino)-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl-diethylazanium (PubChem CID 9234386) has the molecular formula C18H28N3O2+ and a molecular weight of 318.44 g/mol. Its IUPAC name is [5-[(Z)-N-(cyclopropanecarbonylamino)-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl-diethylazanium.
| Compound Name | [5-[(Z)-N-(cyclopropanecarbonylamino)-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl-diethylazanium |
|---|---|
| PubChem CID | 9234386 |
| Molecular Formula | C18H28N3O2+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [5-[(Z)-N-(cyclopropanecarbonylamino)-C-methylcarbonimidoyl]-2-methoxyphenyl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1cc(/C(C)=N\NC(=O)C2CC2)ccc1OC |
| InChI | InChI=1S/C18H27N3O2/c1-5-21(6-2)12-16-11-15(9-10-17(16)23-4)13(3)19-20-18(22)14-7-8-14/h9-11,14H,5-8,12H2,1-4H3,(H,20,22)/p+1/b19-13- |
| InChIKey | CACVWNMKSSONEW-UYRXBGFRSA-O |
| XLogP | 1.37 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|