C12H12F2N2O — CID 9234157
N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide (PubChem CID 9234157) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide.
| Compound Name | N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 9234157 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide |
| SMILES | C/C(=N/NC(=O)C1CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12F2N2O/c1-7(15-16-12(17)8-2-3-8)9-4-5-10(13)11(14)6-9/h4-6,8H,2-3H2,1H3,(H,16,17)/b15-7- |
| InChIKey | YCVLJXFSMHMHLT-CHHVJCJISA-N |
| XLogP | 2.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|