About N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide
N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide (PubChem CID 9234157) has the molecular formula C12H12F2N2O
and a molecular weight of 238.24 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide |
| PubChem CID | 9234157 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide |
| SMILES | C/C(=N/NC(=O)C1CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12F2N2O/c1-7(15-16-12(17)8-2-3-8)9-4-5-10(13)11(14)6-9/h4-6,8H,2-3H2,1H3,(H,16,17)/b15-7- |
| InChIKey | YCVLJXFSMHMHLT-CHHVJCJISA-N |
| XLogP | 2.21 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide?
The IUPAC name of N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide (CID 9234157) is N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide.
What is the SMILES notation for N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide?
The canonical SMILES for N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide is C/C(=N/NC(=O)C1CC1)c1ccc(F)c(F)c1.
What is the InChIKey of N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide?
The InChIKey is YCVLJXFSMHMHLT-CHHVJCJISA-N. The full InChI is InChI=1S/C12H12F2N2O/c1-7(15-16-12(17)8-2-3-8)9-4-5-10(13)11(14)6-9/h4-6,8H,2-3H2,1H3,(H,16,17)/b15-7-.
What are the key properties of N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide?
N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide has a molecular weight of 238.24 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(3,4-difluorophenyl)ethylideneamino]cyclopropanecarboxamide is sourced from PubChem (CID 9234157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).