C17H24N3O2+ — CID 135808115
ethyl-[[(2R)-oxan-2-yl]methyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135808115) has the molecular formula C17H24N3O2+ and a molecular weight of 302.40 g/mol. Its IUPAC name is ethyl-[[(2R)-oxan-2-yl]methyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | ethyl-[[(2R)-oxan-2-yl]methyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135808115 |
| Molecular Formula | C17H24N3O2+ |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethyl-[[(2R)-oxan-2-yl]methyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CC[NH+](Cc1nc2ccccc2c(=O)[nH]1)C[C@H]1CCCCO1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-20(11-13-7-5-6-10-22-13)12-16-18-15-9-4-3-8-14(15)17(21)19-16/h3-4,8-9,13H,2,5-7,10-12H2,1H3,(H,18,19,21)/p+1/t13-/m1/s1 |
| InChIKey | UUBLCEOOXRWCEM-CYBMUJFWSA-O |
| XLogP | 0.90 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |