C19H18N3OS2+ — CID 135751190
(4-oxo-3H-quinazolin-2-yl)methyl-bis(thiophen-2-ylmethyl)azanium (PubChem CID 135751190) has the molecular formula C19H18N3OS2+ and a molecular weight of 368.51 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 135751190 |
| Molecular Formula | C19H18N3OS2+ |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl-bis(thiophen-2-ylmethyl)azanium |
| SMILES | O=c1[nH]c(C[NH+](Cc2cccs2)Cc2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C19H17N3OS2/c23-19-16-7-1-2-8-17(16)20-18(21-19)13-22(11-14-5-3-9-24-14)12-15-6-4-10-25-15/h1-10H,11-13H2,(H,20,21,23)/p+1 |
| InChIKey | OIODNDIDLZJEIS-UHFFFAOYSA-O |
| XLogP | 2.83 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |