C22H20N4O3S — CID 135429181
3-(2-methoxyphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-1-(thiophen-2-ylmethyl)urea (PubChem CID 135429181) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-(2-methoxyphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 135429181 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-1-(thiophen-2-ylmethyl)urea |
| SMILES | COc1ccccc1NC(=O)N(Cc1nc2ccccc2c(=O)[nH]1)Cc1cccs1 |
| InChI | InChI=1S/C22H20N4O3S/c1-29-19-11-5-4-10-18(19)24-22(28)26(13-15-7-6-12-30-15)14-20-23-17-9-3-2-8-16(17)21(27)25-20/h2-12H,13-14H2,1H3,(H,24,28)(H,23,25,27) |
| InChIKey | XHAWJVRZOCPDKR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |