C9H11Cl2N3O — CID 137032189
2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride (PubChem CID 137032189) has the molecular formula C9H11Cl2N3O and a molecular weight of 248.11 g/mol. Its IUPAC name is 2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride.
| Compound Name | 2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 137032189 |
| Molecular Formula | C9H11Cl2N3O |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 2-(aminomethyl)-3H-quinazolin-4-one;dihydrochloride |
| SMILES | Cl.Cl.NCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H9N3O.2ClH/c10-5-8-11-7-4-2-1-3-6(7)9(13)12-8;;/h1-4H,5,10H2,(H,11,12,13);2*1H |
| InChIKey | JFITWZBSSYVVQN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |