C13H14N4O4 — CID 136776108
2-[(2-amino-2-oxoethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetic acid (PubChem CID 136776108) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 136776108 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H14N4O4/c14-10(18)5-17(7-12(19)20)6-11-15-9-4-2-1-3-8(9)13(21)16-11/h1-4H,5-7H2,(H2,14,18)(H,19,20)(H,15,16,21) |
| InChIKey | UZYQRCPHUWJSJT-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |