C15H21N3O — CID 162424449
2-[[methyl(3-methylbutyl)amino]methyl]-3H-quinazolin-4-one (PubChem CID 162424449) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[[methyl(3-methylbutyl)amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[methyl(3-methylbutyl)amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 162424449 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-[[methyl(3-methylbutyl)amino]methyl]-3H-quinazolin-4-one |
| SMILES | CC(C)CCN(C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H21N3O/c1-11(2)8-9-18(3)10-14-16-13-7-5-4-6-12(13)15(19)17-14/h4-7,11H,8-10H2,1-3H3,(H,16,17,19) |
| InChIKey | UVMYEMYWRAPEPK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |