C18H18ClN3O — CID 135909602
2-[[[(1S)-1-(2-chlorophenyl)ethyl]-methylamino]methyl]-3H-quinazolin-4-one (PubChem CID 135909602) has the molecular formula C18H18ClN3O and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-[[[(1S)-1-(2-chlorophenyl)ethyl]-methylamino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[[(1S)-1-(2-chlorophenyl)ethyl]-methylamino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135909602 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[[[(1S)-1-(2-chlorophenyl)ethyl]-methylamino]methyl]-3H-quinazolin-4-one |
| SMILES | C[C@@H](c1ccccc1Cl)N(C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H18ClN3O/c1-12(13-7-3-5-9-15(13)19)22(2)11-17-20-16-10-6-4-8-14(16)18(23)21-17/h3-10,12H,11H2,1-2H3,(H,20,21,23)/t12-/m0/s1 |
| InChIKey | RWTWVJBHVIBUMF-LBPRGKRZSA-N |
| XLogP | 3.77 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |