C18H17ClFN3O — CID 135808901
2-[(1R)-1-[(2-chloro-6-fluorophenyl)methyl-methylamino]ethyl]-3H-quinazolin-4-one (PubChem CID 135808901) has the molecular formula C18H17ClFN3O and a molecular weight of 345.81 g/mol. Its IUPAC name is 2-[(1R)-1-[(2-chloro-6-fluorophenyl)methyl-methylamino]ethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(1R)-1-[(2-chloro-6-fluorophenyl)methyl-methylamino]ethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135808901 |
| Molecular Formula | C18H17ClFN3O |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-[(1R)-1-[(2-chloro-6-fluorophenyl)methyl-methylamino]ethyl]-3H-quinazolin-4-one |
| SMILES | C[C@H](c1nc2ccccc2c(=O)[nH]1)N(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H17ClFN3O/c1-11(23(2)10-13-14(19)7-5-8-15(13)20)17-21-16-9-4-3-6-12(16)18(24)22-17/h3-9,11H,10H2,1-2H3,(H,21,22,24)/t11-/m1/s1 |
| InChIKey | BVXZYBVAPUBFNV-LLVKDONJSA-N |
| XLogP | 3.91 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |