C19H19ClN4O2 — CID 135920487
(2R)-N-(4-chlorophenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanamide (PubChem CID 135920487) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 135920487 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(Cl)cc1)N(C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-12(18(25)21-14-9-7-13(20)8-10-14)24(2)11-17-22-16-6-4-3-5-15(16)19(26)23-17/h3-10,12H,11H2,1-2H3,(H,21,25)(H,22,23,26)/t12-/m1/s1 |
| InChIKey | XMMIMCABEAJPRH-GFCCVEGCSA-N |
| XLogP | 3.04 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |