C21H24N4O2 — CID 136929486
1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 136929486) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 136929486 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H24N4O2/c1-4-25(21(27)22-16-11-9-15(10-12-16)14(2)3)13-19-23-18-8-6-5-7-17(18)20(26)24-19/h5-12,14H,4,13H2,1-3H3,(H,22,27)(H,23,24,26) |
| InChIKey | SIFXOMNPRKNAAF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |