C15H11BrN2O — CID 137240406
2-[(4-bromophenyl)methyl]-3H-quinazolin-4-one (PubChem CID 137240406) has the molecular formula C15H11BrN2O and a molecular weight of 315.17 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(4-bromophenyl)methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137240406 |
| Molecular Formula | C15H11BrN2O |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(Cc2ccc(Br)cc2)nc2ccccc12 |
| InChI | InChI=1S/C15H11BrN2O/c16-11-7-5-10(6-8-11)9-14-17-13-4-2-1-3-12(13)15(19)18-14/h1-8H,9H2,(H,17,18,19) |
| InChIKey | JMFGGSMDONSAFI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |