C16H11N2NaO3 — CID 137193206
sodium 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate (PubChem CID 137193206) has the molecular formula C16H11N2NaO3 and a molecular weight of 302.27 g/mol. Its IUPAC name is sodium 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate.
| Compound Name | sodium 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 137193206 |
| Molecular Formula | C16H11N2NaO3 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | sodium 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate |
| SMILES | O=C([O-])c1ccccc1Cc1nc2ccccc2c(=O)[nH]1.[Na+] |
| InChI | InChI=1S/C16H12N2O3.Na/c19-15-12-7-3-4-8-13(12)17-14(18-15)9-10-5-1-2-6-11(10)16(20)21;/h1-8H,9H2,(H,20,21)(H,17,18,19);/q;+1/p-1 |
| InChIKey | ZTVVDDHLGWWCIQ-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |