About 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate
3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate (PubChem CID 135974307) has the molecular formula C25H20N2O3
and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate.
Molecular Properties
| Compound Name | 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate |
| PubChem CID | 135974307 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate |
| SMILES | O=C(OCC=Cc1ccccc1)c1ccccc1Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H20N2O3/c28-24-21-14-6-7-15-22(21)26-23(27-24)17-19-12-4-5-13-20(19)25(29)30-16-8-11-18-9-2-1-3-10-18/h1-15H,16-17H2,(H,26,27,28) |
| InChIKey | ZZSSPFOWTVEXDJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate?
The IUPAC name of 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate (CID 135974307) is 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate.
What is the SMILES notation for 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate?
The canonical SMILES for 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate is O=C(OCC=Cc1ccccc1)c1ccccc1Cc1nc2ccccc2c(=O)[nH]1.
What is the InChIKey of 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate?
The InChIKey is ZZSSPFOWTVEXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O3/c28-24-21-14-6-7-15-22(21)26-23(27-24)17-19-12-4-5-13-20(19)25(29)30-16-8-11-18-9-2-1-3-10-18/h1-15H,16-17H2,(H,26,27,28).
What are the key properties of 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate?
3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate has a molecular weight of 396.45 g/mol, XLogP of 4.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl 2-[(4-oxo-3H-quinazolin-2-yl)methyl]benzoate is sourced from PubChem (CID 135974307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).