C16H13ClN2OS — CID 135729485
2-[(4-chlorophenyl)methylsulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135729485) has the molecular formula C16H13ClN2OS and a molecular weight of 316.81 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135729485 |
| Molecular Formula | C16H13ClN2OS |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSCc2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C16H13ClN2OS/c17-12-7-5-11(6-8-12)9-21-10-15-18-14-4-2-1-3-13(14)16(20)19-15/h1-8H,9-10H2,(H,18,19,20) |
| InChIKey | XCQZQDFVCZTBCA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |