C21H16ClN3O3 — CID 135429053
N-[(4-chlorophenyl)methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide (PubChem CID 135429053) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135429053 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-[(4-oxo-3H-quinazolin-2-yl)methyl]furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(Cc1ccc(Cl)cc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H16ClN3O3/c22-15-9-7-14(8-10-15)12-25(21(27)18-6-3-11-28-18)13-19-23-17-5-2-1-4-16(17)20(26)24-19/h1-11H,12-13H2,(H,23,24,26) |
| InChIKey | MGSZTRIDMZTQJX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |