C23H18FN3O2 — CID 135478220
N-benzyl-2-fluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 135478220) has the molecular formula C23H18FN3O2 and a molecular weight of 387.41 g/mol. Its IUPAC name is N-benzyl-2-fluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | N-benzyl-2-fluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135478220 |
| Molecular Formula | C23H18FN3O2 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-benzyl-2-fluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | O=C(c1ccccc1F)N(Cc1ccccc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H18FN3O2/c24-19-12-6-4-10-17(19)23(29)27(14-16-8-2-1-3-9-16)15-21-25-20-13-7-5-11-18(20)22(28)26-21/h1-13H,14-15H2,(H,25,26,28) |
| InChIKey | KZBTYBSHTFGAQJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |