C24H19F2N3O3 — CID 135738144
N-benzyl-2-(difluoromethoxy)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 135738144) has the molecular formula C24H19F2N3O3 and a molecular weight of 435.43 g/mol. Its IUPAC name is N-benzyl-2-(difluoromethoxy)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | N-benzyl-2-(difluoromethoxy)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135738144 |
| Molecular Formula | C24H19F2N3O3 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-benzyl-2-(difluoromethoxy)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | O=C(c1ccccc1OC(F)F)N(Cc1ccccc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H19F2N3O3/c25-24(26)32-20-13-7-5-11-18(20)23(31)29(14-16-8-2-1-3-9-16)15-21-27-19-12-6-4-10-17(19)22(30)28-21/h1-13,24H,14-15H2,(H,27,28,30) |
| InChIKey | WCWARUSWNXAOMN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |