C23H17Cl2N3O2 — CID 135738069
N-benzyl-2,5-dichloro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 135738069) has the molecular formula C23H17Cl2N3O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is N-benzyl-2,5-dichloro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | N-benzyl-2,5-dichloro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135738069 |
| Molecular Formula | C23H17Cl2N3O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N-benzyl-2,5-dichloro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N(Cc1ccccc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H17Cl2N3O2/c24-16-10-11-19(25)18(12-16)23(30)28(13-15-6-2-1-3-7-15)14-21-26-20-9-5-4-8-17(20)22(29)27-21/h1-12H,13-14H2,(H,26,27,29) |
| InChIKey | FRKOMJQXECSZJY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |