C24H20ClN3O2S — CID 135738118
N-benzyl-2-(4-chlorophenyl)sulfanyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide (PubChem CID 135738118) has the molecular formula C24H20ClN3O2S and a molecular weight of 449.96 g/mol. Its IUPAC name is N-benzyl-2-(4-chlorophenyl)sulfanyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-(4-chlorophenyl)sulfanyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 135738118 |
| Molecular Formula | C24H20ClN3O2S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-benzyl-2-(4-chlorophenyl)sulfanyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)N(Cc1ccccc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H20ClN3O2S/c25-18-10-12-19(13-11-18)31-16-23(29)28(14-17-6-2-1-3-7-17)15-22-26-21-9-5-4-8-20(21)24(30)27-22/h1-13H,14-16H2,(H,26,27,30) |
| InChIKey | GSWFIICUKAYRPI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |