C19H17NO2 — CID 762503
N,N-dibenzylfuran-2-carboxamide (PubChem CID 762503) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N,N-dibenzylfuran-2-carboxamide.
| Compound Name | N,N-dibenzylfuran-2-carboxamide |
|---|---|
| PubChem CID | 762503 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N,N-dibenzylfuran-2-carboxamide |
| SMILES | O=C(c1ccco1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H17NO2/c21-19(18-12-7-13-22-18)20(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2 |
| InChIKey | GOAYYTQBZIUOKG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |