C18H17NO3 — CID 42773267
N-(furan-2-ylmethyl)-N-(2-phenylethyl)furan-2-carboxamide (PubChem CID 42773267) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(2-phenylethyl)furan-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(2-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42773267 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(2-phenylethyl)furan-2-carboxamide |
| SMILES | O=C(c1ccco1)N(CCc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C18H17NO3/c20-18(17-9-5-13-22-17)19(14-16-8-4-12-21-16)11-10-15-6-2-1-3-7-15/h1-9,12-13H,10-11,14H2 |
| InChIKey | YTKPMEMSNVGRMZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |