C20H22N4O2 — CID 72842683
2-(ethylamino)-N-(furan-2-ylmethyl)-N-(2-phenylethyl)pyrimidine-5-carboxamide (PubChem CID 72842683) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(ethylamino)-N-(furan-2-ylmethyl)-N-(2-phenylethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(ethylamino)-N-(furan-2-ylmethyl)-N-(2-phenylethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72842683 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-(ethylamino)-N-(furan-2-ylmethyl)-N-(2-phenylethyl)pyrimidine-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)N(CCc2ccccc2)Cc2ccco2)cn1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-21-20-22-13-17(14-23-20)19(25)24(15-18-9-6-12-26-18)11-10-16-7-4-3-5-8-16/h3-9,12-14H,2,10-11,15H2,1H3,(H,21,22,23) |
| InChIKey | QZJBFEXJGLPUDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |