C24H27NO2 — CID 4518534
N-benzyl-N-(furan-2-ylmethyl)-4-pentylbenzamide (PubChem CID 4518534) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-benzyl-N-(furan-2-ylmethyl)-4-pentylbenzamide.
| Compound Name | N-benzyl-N-(furan-2-ylmethyl)-4-pentylbenzamide |
|---|---|
| PubChem CID | 4518534 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-benzyl-N-(furan-2-ylmethyl)-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(Cc2ccccc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H27NO2/c1-2-3-5-9-20-13-15-22(16-14-20)24(26)25(19-23-12-8-17-27-23)18-21-10-6-4-7-11-21/h4,6-8,10-17H,2-3,5,9,18-19H2,1H3 |
| InChIKey | SHMLCHITAALYTE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|