C25H28N2O3 — CID 3596156
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-N-propylbenzamide (PubChem CID 3596156) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-N-propylbenzamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-N-propylbenzamide |
|---|---|
| PubChem CID | 3596156 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-methyl-N-propylbenzamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-3-15-26(25(29)22-13-11-20(2)12-14-22)19-24(28)27(18-23-10-7-16-30-23)17-21-8-5-4-6-9-21/h4-14,16H,3,15,17-19H2,1-2H3 |
| InChIKey | BOQSVGAGMAKTFN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |