C31H32N2O4 — CID 5166760
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide (PubChem CID 5166760) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 5166760 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)-4-phenylbenzamide |
| SMILES | COCCCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H32N2O4/c1-36-20-9-19-32(31(35)28-17-15-27(16-18-28)26-12-6-3-7-13-26)24-30(34)33(23-29-14-8-21-37-29)22-25-10-4-2-5-11-25/h2-8,10-18,21H,9,19-20,22-24H2,1H3 |
| InChIKey | LZXXUSRWQKWOSX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|