C23H32N2O4 — CID 5238006
N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide (PubChem CID 5238006) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide.
| Compound Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide |
|---|---|
| PubChem CID | 5238006 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-methoxypropyl)pentanamide |
| SMILES | CCCCC(=O)N(CCCOC)CC(=O)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C23H32N2O4/c1-3-4-13-22(26)24(14-9-15-28-2)19-23(27)25(18-21-12-8-16-29-21)17-20-10-6-5-7-11-20/h5-8,10-12,16H,3-4,9,13-15,17-19H2,1-2H3 |
| InChIKey | MPQAUOSPKAVTKW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|