C24H32N2O6 — CID 3459730
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methoxyethyl)hexanamide (PubChem CID 3459730) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methoxyethyl)hexanamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methoxyethyl)hexanamide |
|---|---|
| PubChem CID | 3459730 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-methoxyethyl)hexanamide |
| SMILES | CCCCCC(=O)N(CCOC)CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1ccco1 |
| InChI | InChI=1S/C24H32N2O6/c1-3-4-5-8-23(27)25(11-13-29-2)17-24(28)26(16-20-7-6-12-30-20)15-19-9-10-21-22(14-19)32-18-31-21/h6-7,9-10,12,14H,3-5,8,11,13,15-18H2,1-2H3 |
| InChIKey | SLCWIVXCVXRPEA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|