C26H30N2O6S — CID 42773471
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)-2-thiophen-2-ylacetamide (PubChem CID 42773471) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 42773471 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-ethoxypropyl)-2-thiophen-2-ylacetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1ccco1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C26H30N2O6S/c1-2-31-11-5-10-27(25(29)15-22-7-4-13-35-22)18-26(30)28(17-21-6-3-12-32-21)16-20-8-9-23-24(14-20)34-19-33-23/h3-4,6-9,12-14H,2,5,10-11,15-19H2,1H3 |
| InChIKey | DRNMERPHYYPGAV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|