C27H28Cl2N2O6 — CID 4621699
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-3,5-dichloro-N-(3-ethoxypropyl)benzamide (PubChem CID 4621699) has the molecular formula C27H28Cl2N2O6 and a molecular weight of 547.44 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-3,5-dichloro-N-(3-ethoxypropyl)benzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-3,5-dichloro-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 4621699 |
| Molecular Formula | C27H28Cl2N2O6 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-3,5-dichloro-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1ccco1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C27H28Cl2N2O6/c1-2-34-9-4-8-30(27(33)20-12-21(28)14-22(29)13-20)17-26(32)31(16-23-5-3-10-35-23)15-19-6-7-24-25(11-19)37-18-36-24/h3,5-7,10-14H,2,4,8-9,15-18H2,1H3 |
| InChIKey | HHVGFIJGYCBTLI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|