C27H29ClN2O6 — CID 3550859
N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-ethoxypropyl)benzamide (PubChem CID 3550859) has the molecular formula C27H29ClN2O6 and a molecular weight of 512.99 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-ethoxypropyl)benzamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 3550859 |
| Molecular Formula | C27H29ClN2O6 |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(furan-2-ylmethyl)amino]-2-oxoethyl]-4-chloro-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1ccco1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H29ClN2O6/c1-2-33-13-4-12-29(27(32)21-7-9-22(28)10-8-21)18-26(31)30(17-23-5-3-14-34-23)16-20-6-11-24-25(15-20)36-19-35-24/h3,5-11,14-15H,2,4,12-13,16-19H2,1H3 |
| InChIKey | LJYACMLIGMKBHR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 81.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|