C26H30N2O4 — CID 42773035
N-benzyl-N-(furan-2-ylmethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide (PubChem CID 42773035) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-benzyl-N-(furan-2-ylmethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide.
| Compound Name | N-benzyl-N-(furan-2-ylmethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide |
|---|---|
| PubChem CID | 42773035 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-benzyl-N-(furan-2-ylmethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)Cc1ccco1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C26H30N2O4/c1-2-15-27(26(30)21-31-20-23-12-7-4-8-13-23)19-25(29)28(18-24-14-9-16-32-24)17-22-10-5-3-6-11-22/h3-14,16H,2,15,17-21H2,1H3 |
| InChIKey | PMHHUUKIPHJFDJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |