C27H32N2O4 — CID 3581106
N-(furan-2-ylmethyl)-N-(2-phenylethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide (PubChem CID 3581106) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(2-phenylethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(2-phenylethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide |
|---|---|
| PubChem CID | 3581106 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(2-phenylethyl)-2-[(2-phenylmethoxyacetyl)-propylamino]acetamide |
| SMILES | CCCN(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O4/c1-2-16-28(27(31)22-32-21-24-12-7-4-8-13-24)20-26(30)29(19-25-14-9-18-33-25)17-15-23-10-5-3-6-11-23/h3-14,18H,2,15-17,19-22H2,1H3 |
| InChIKey | DFCQVLSGVUMSSB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |