C27H30N2O3 — CID 4580452
N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide (PubChem CID 4580452) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide.
| Compound Name | N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 4580452 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(2-phenylethyl)amino]-2-oxoethyl]-3-phenyl-N-propylprop-2-enamide |
| SMILES | CCCN(CC(=O)N(CCc1ccccc1)Cc1ccco1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O3/c1-2-18-28(26(30)16-15-23-10-5-3-6-11-23)22-27(31)29(21-25-14-9-20-32-25)19-17-24-12-7-4-8-13-24/h3-16,20H,2,17-19,21-22H2,1H3 |
| InChIKey | LMYVWBRBZDMGSY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|