C29H33N3O4 — CID 6004837
(E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-phenylprop-2-enamide (PubChem CID 6004837) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is (E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6004837 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(2-morpholin-4-ylethyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(CCN1CCOCC1)CC(=O)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C29H33N3O4/c33-28(14-13-25-8-3-1-4-9-25)31(16-15-30-17-20-35-21-18-30)24-29(34)32(23-27-12-7-19-36-27)22-26-10-5-2-6-11-26/h1-14,19H,15-18,20-24H2/b14-13+ |
| InChIKey | BYLKAVUCHGLANP-BUHFOSPRSA-N |
| XLogP | 3.68 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|