C27H32N4O4 — CID 42773151
N-benzyl-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(phenylcarbamoyl)amino]acetamide (PubChem CID 42773151) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-benzyl-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(phenylcarbamoyl)amino]acetamide.
| Compound Name | N-benzyl-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(phenylcarbamoyl)amino]acetamide |
|---|---|
| PubChem CID | 42773151 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | N-benzyl-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl(phenylcarbamoyl)amino]acetamide |
| SMILES | O=C(CN(CCN1CCOCC1)C(=O)Nc1ccccc1)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C27H32N4O4/c32-26(31(21-25-12-7-17-35-25)20-23-8-3-1-4-9-23)22-30(14-13-29-15-18-34-19-16-29)27(33)28-24-10-5-2-6-11-24/h1-12,17H,13-16,18-22H2,(H,28,33) |
| InChIKey | XYIASRIMJJWPBM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |