C30H35N3O4 — CID 6012187
(E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide (PubChem CID 6012187) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is (E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6012187 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | (E)-N-[2-[benzyl(furan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(CCCN1CCOCC1)CC(=O)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C30H35N3O4/c34-29(15-14-26-9-3-1-4-10-26)32(17-8-16-31-18-21-36-22-19-31)25-30(35)33(24-28-13-7-20-37-28)23-27-11-5-2-6-12-27/h1-7,9-15,20H,8,16-19,21-25H2/b15-14+ |
| InChIKey | SCXXRAQAITWNJI-CCEZHUSRSA-N |
| XLogP | 4.07 |
| TPSA | 66.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|