C28H36N4O7 — CID 4040954
N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 4040954) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4040954 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-N-(3-morpholin-4-ylpropyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])cc1)N(CCCN1CCOCC1)CC(=O)N(Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C28H36N4O7/c33-27(11-8-23-6-9-24(10-7-23)32(35)36)30(13-3-12-29-14-18-37-19-15-29)22-28(34)31(20-25-4-1-16-38-25)21-26-5-2-17-39-26/h1,4,6-11,16,26H,2-3,5,12-15,17-22H2 |
| InChIKey | CFOPYVXMRPPKGO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|